C21H32IN5O — CID 111849552
1-(3-cyclopentyloxypropyl)-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111849552) has the molecular formula C21H32IN5O and a molecular weight of 497.43 g/mol. Its IUPAC name is 1-(3-cyclopentyloxypropyl)-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-cyclopentyloxypropyl)-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111849552 |
| Molecular Formula | C21H32IN5O |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 1-(3-cyclopentyloxypropyl)-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOC1CCCC1)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C21H31N5O.HI/c1-22-21(23-12-7-15-27-20-10-4-5-11-20)24-16-18-8-2-3-9-19(18)17-26-14-6-13-25-26;/h2-3,6,8-9,13-14,20H,4-5,7,10-12,15-17H2,1H3,(H2,22,23,24);1H |
| InChIKey | ZYCZSJOEOVAHFA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|