C23H37IN6 — CID 111850923
1-[3-[cyclohexyl(methyl)amino]propyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111850923) has the molecular formula C23H37IN6 and a molecular weight of 524.50 g/mol. Its IUPAC name is 1-[3-[cyclohexyl(methyl)amino]propyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-[cyclohexyl(methyl)amino]propyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111850923 |
| Molecular Formula | C23H37IN6 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 1-[3-[cyclohexyl(methyl)amino]propyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCN(C)C1CCCCC1)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C23H36N6.HI/c1-24-23(25-14-8-16-28(2)22-12-4-3-5-13-22)26-18-20-10-6-7-11-21(20)19-29-17-9-15-27-29;/h6-7,9-11,15,17,22H,3-5,8,12-14,16,18-19H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | SIUWXAHOWZJOJY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|