C24H34IN9 — CID 111851567
2-methyl-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111851567) has the molecular formula C24H34IN9 and a molecular weight of 575.50 g/mol. Its IUPAC name is 2-methyl-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111851567 |
| Molecular Formula | C24H34IN9 |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 2-methyl-1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(c2ncccn2)CC1)NCc1ccccc1Cn1cccn1.I |
| InChI | InChI=1S/C24H33N9.HI/c1-25-23(29-19-21-7-2-3-8-22(21)20-33-14-6-12-30-33)26-11-5-13-31-15-17-32(18-16-31)24-27-9-4-10-28-24;/h2-4,6-10,12,14H,5,11,13,15-20H2,1H3,(H2,25,26,29);1H |
| InChIKey | OFJUHMLENSXSRH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|