C17H30IN5 — CID 111209976
N',4-dimethyl-N-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111209976) has the molecular formula C17H30IN5 and a molecular weight of 431.37 g/mol. Its IUPAC name is N',4-dimethyl-N-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N',4-dimethyl-N-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111209976 |
| Molecular Formula | C17H30IN5 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N',4-dimethyl-N-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCNc1ccccn1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C17H29N5.HI/c1-15-8-13-22(14-9-15)17(18-2)21-12-6-5-11-20-16-7-3-4-10-19-16;/h3-4,7,10,15H,5-6,8-9,11-14H2,1-2H3,(H,18,21)(H,19,20);1H |
| InChIKey | HPKIIALRRXSNAT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|