C22H29N5 — CID 111263201
N'-methyl-4-phenyl-N-[4-(pyridin-2-ylamino)butyl]-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 111263201) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is N'-methyl-4-phenyl-N-[4-(pyridin-2-ylamino)butyl]-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N'-methyl-4-phenyl-N-[4-(pyridin-2-ylamino)butyl]-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 111263201 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N'-methyl-4-phenyl-N-[4-(pyridin-2-ylamino)butyl]-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCNc1ccccn1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N5/c1-23-22(26-16-8-7-15-25-21-11-5-6-14-24-21)27-17-12-20(13-18-27)19-9-3-2-4-10-19/h2-6,9-12,14H,7-8,13,15-18H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | JDGJFJITHZPJEU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|