C19H25N5 — CID 111264045
N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 111264045) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 111264045 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1cnn(C)c1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N5/c1-20-19(21-11-8-16-14-22-23(2)15-16)24-12-9-18(10-13-24)17-6-4-3-5-7-17/h3-7,9,14-15H,8,10-13H2,1-2H3,(H,20,21) |
| InChIKey | NTMROSAYBPELDS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|