C22H37IN4 — CID 111263288
N-[7-(dimethylamino)heptyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide (PubChem CID 111263288) has the molecular formula C22H37IN4 and a molecular weight of 484.47 g/mol. Its IUPAC name is N-[7-(dimethylamino)heptyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide.
| Compound Name | N-[7-(dimethylamino)heptyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111263288 |
| Molecular Formula | C22H37IN4 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[7-(dimethylamino)heptyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCCCCCN(C)C)N1CC=C(c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H36N4.HI/c1-23-22(24-16-10-5-4-6-11-17-25(2)3)26-18-14-21(15-19-26)20-12-8-7-9-13-20;/h7-9,12-14H,4-6,10-11,15-19H2,1-3H3,(H,23,24);1H |
| InChIKey | BVCRPOINQAMGHY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|