C18H26N6 — CID 110961665
N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-4-phenylpiperazine-1-carboximidamide (PubChem CID 110961665) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110961665 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | N'-methyl-N-[2-(1-methylpyrazol-4-yl)ethyl]-4-phenylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1cnn(C)c1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N6/c1-19-18(20-9-8-16-14-21-22(2)15-16)24-12-10-23(11-13-24)17-6-4-3-5-7-17/h3-7,14-15H,8-13H2,1-2H3,(H,19,20) |
| InChIKey | JNZPFEKJCMUENJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|