C17H24N6 — CID 110962115
N'-methyl-4-phenyl-N-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide (PubChem CID 110962115) has the molecular formula C17H24N6 and a molecular weight of 312.42 g/mol. Its IUPAC name is N'-methyl-4-phenyl-N-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-phenyl-N-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110962115 |
| Molecular Formula | C17H24N6 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | N'-methyl-4-phenyl-N-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCn1cccn1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N6/c1-18-17(19-9-11-23-10-5-8-20-23)22-14-12-21(13-15-22)16-6-3-2-4-7-16/h2-8,10H,9,11-15H2,1H3,(H,18,19) |
| InChIKey | QHHMUKMAIXVRLD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|