C18H26ClIN6 — CID 111264168
4-(5-chloro-2-methylphenyl)-N'-methyl-N-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111264168) has the molecular formula C18H26ClIN6 and a molecular weight of 488.81 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111264168 |
| Molecular Formula | C18H26ClIN6 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N'-methyl-N-(2-pyrazol-1-ylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCn1cccn1)N1CCN(c2cc(Cl)ccc2C)CC1.I |
| InChI | InChI=1S/C18H25ClN6.HI/c1-15-4-5-16(19)14-17(15)23-10-12-24(13-11-23)18(20-2)21-7-9-25-8-3-6-22-25;/h3-6,8,14H,7,9-13H2,1-2H3,(H,20,21);1H |
| InChIKey | YIQGDUBCXZHAIU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|