C17H27ClN4O2S — CID 111264107
4-(5-chloro-2-methylphenyl)-N-(2-ethylsulfonylethyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111264107) has the molecular formula C17H27ClN4O2S and a molecular weight of 386.95 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-(2-ethylsulfonylethyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-(2-ethylsulfonylethyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111264107 |
| Molecular Formula | C17H27ClN4O2S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-(2-ethylsulfonylethyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C17H27ClN4O2S/c1-4-25(23,24)12-7-20-17(19-3)22-10-8-21(9-11-22)16-13-15(18)6-5-14(16)2/h5-6,13H,4,7-12H2,1-3H3,(H,19,20) |
| InChIKey | PDEGEASASDGCDV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|