C22H29ClN4O2S — CID 111264121
4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[(4-methylsulfonylphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111264121) has the molecular formula C22H29ClN4O2S and a molecular weight of 449.02 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[(4-methylsulfonylphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[(4-methylsulfonylphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111264121 |
| Molecular Formula | C22H29ClN4O2S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[(4-methylsulfonylphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(S(C)(=O)=O)cc1)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C22H29ClN4O2S/c1-4-24-22(25-16-18-6-9-20(10-7-18)30(3,28)29)27-13-11-26(12-14-27)21-15-19(23)8-5-17(21)2/h5-10,15H,4,11-14,16H2,1-3H3,(H,24,25) |
| InChIKey | YFHJBFGJJMRXGG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|