C22H36ClN5O — CID 111264177
4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[3-(4-hydroxypiperidin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111264177) has the molecular formula C22H36ClN5O and a molecular weight of 422.02 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[3-(4-hydroxypiperidin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[3-(4-hydroxypiperidin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111264177 |
| Molecular Formula | C22H36ClN5O |
| Molecular Weight | 422.02 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-ethyl-N'-[3-(4-hydroxypiperidin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN1CCC(O)CC1)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C22H36ClN5O/c1-3-24-22(25-9-4-10-26-11-7-20(29)8-12-26)28-15-13-27(14-16-28)21-17-19(23)6-5-18(21)2/h5-6,17,20,29H,3-4,7-16H2,1-2H3,(H,24,25) |
| InChIKey | UIAKKQRYBVOZCS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.02 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|