C21H33F2N5 — CID 109451249
4-(2,5-difluorophenyl)-N-ethyl-N'-(4-pyrrolidin-1-ylbutyl)piperazine-1-carboximidamide (PubChem CID 109451249) has the molecular formula C21H33F2N5 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-(4-pyrrolidin-1-ylbutyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-(4-pyrrolidin-1-ylbutyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451249 |
| Molecular Formula | C21H33F2N5 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-(4-pyrrolidin-1-ylbutyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN1CCCC1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C21H33F2N5/c1-2-24-21(25-9-3-4-10-26-11-5-6-12-26)28-15-13-27(14-16-28)20-17-18(22)7-8-19(20)23/h7-8,17H,2-6,9-16H2,1H3,(H,24,25) |
| InChIKey | QGJOVAUIFCHZMH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|