C16H20F2N4 — CID 109451231
4-(2,5-difluorophenyl)-N-ethyl-N'-prop-2-ynylpiperazine-1-carboximidamide (PubChem CID 109451231) has the molecular formula C16H20F2N4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-prop-2-ynylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-prop-2-ynylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451231 |
| Molecular Formula | C16H20F2N4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-prop-2-ynylpiperazine-1-carboximidamide |
| SMILES | C#CC/N=C(\NCC)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H20F2N4/c1-3-7-20-16(19-4-2)22-10-8-21(9-11-22)15-12-13(17)5-6-14(15)18/h1,5-6,12H,4,7-11H2,2H3,(H,19,20) |
| InChIKey | LEWWIUJQFWONOE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|