C18H24F2IN5S — CID 109450894
4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109450894) has the molecular formula C18H24F2IN5S and a molecular weight of 507.39 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450894 |
| Molecular Formula | C18H24F2IN5S |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-methyl-1,3-thiazol-5-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1scnc1C)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C18H23F2N5S.HI/c1-3-21-18(22-11-17-13(2)23-12-26-17)25-8-6-24(7-9-25)16-10-14(19)4-5-15(16)20;/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,21,22);1H |
| InChIKey | IHPJHJFQWLTRBP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|