C22H26F2IN7 — CID 109450736
4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109450736) has the molecular formula C22H26F2IN7 and a molecular weight of 553.40 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450736 |
| Molecular Formula | C22H26F2IN7 |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1-c1ccccc1)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C22H25F2N7.HI/c1-2-25-22(26-15-21-28-27-16-31(21)18-6-4-3-5-7-18)30-12-10-29(11-13-30)20-14-17(23)8-9-19(20)24;/h3-9,14,16H,2,10-13,15H2,1H3,(H,25,26);1H |
| InChIKey | ICERDKSPAJIVBZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|