C17H22F2N6 — CID 109451521
4-(2,5-difluorophenyl)-N-ethyl-N'-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide (PubChem CID 109451521) has the molecular formula C17H22F2N6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451521 |
| Molecular Formula | C17H22F2N6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-(1H-pyrazol-5-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H22F2N6/c1-2-20-17(21-12-14-5-6-22-23-14)25-9-7-24(8-10-25)16-11-13(18)3-4-15(16)19/h3-6,11H,2,7-10,12H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | MWEWYRSCXKBLNG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|