C18H27F2IN4O — CID 109450696
4-(2,5-difluorophenyl)-N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 109450696) has the molecular formula C18H27F2IN4O and a molecular weight of 480.34 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450696 |
| Molecular Formula | C18H27F2IN4O |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[[1-(hydroxymethyl)cyclopropyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(CO)CC1)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C18H26F2N4O.HI/c1-2-21-17(22-12-18(13-25)5-6-18)24-9-7-23(8-10-24)16-11-14(19)3-4-15(16)20;/h3-4,11,25H,2,5-10,12-13H2,1H3,(H,21,22);1H |
| InChIKey | QPEOALHZJCAYRN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|