C20H32F2N4O — CID 109451205
4-(2,5-difluorophenyl)-N-ethyl-N'-[2-(2-hydroxyethyl)pentyl]piperazine-1-carboximidamide (PubChem CID 109451205) has the molecular formula C20H32F2N4O and a molecular weight of 382.50 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-[2-(2-hydroxyethyl)pentyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[2-(2-hydroxyethyl)pentyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451205 |
| Molecular Formula | C20H32F2N4O |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[2-(2-hydroxyethyl)pentyl]piperazine-1-carboximidamide |
| SMILES | CCCC(CCO)C/N=C(\NCC)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H32F2N4O/c1-3-5-16(8-13-27)15-24-20(23-4-2)26-11-9-25(10-12-26)19-14-17(21)6-7-18(19)22/h6-7,14,16,27H,3-5,8-13,15H2,1-2H3,(H,23,24) |
| InChIKey | NPNSAFXBESJJCY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|