C20H32F2N6 — CID 109450715
4-(2,5-difluorophenyl)-N'-[(1,4-dimethylpiperazin-2-yl)methyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 109450715) has the molecular formula C20H32F2N6 and a molecular weight of 394.51 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-[(1,4-dimethylpiperazin-2-yl)methyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-[(1,4-dimethylpiperazin-2-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109450715 |
| Molecular Formula | C20H32F2N6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-[(1,4-dimethylpiperazin-2-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC1CN(C)CCN1C)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H32F2N6/c1-4-23-20(24-14-17-15-25(2)7-8-26(17)3)28-11-9-27(10-12-28)19-13-16(21)5-6-18(19)22/h5-6,13,17H,4,7-12,14-15H2,1-3H3,(H,23,24) |
| InChIKey | CLJARTYWFIALSU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|