C21H33F2N5 — CID 109450801
4-(2,5-difluorophenyl)-N'-methyl-N-[(1-propylpiperidin-4-yl)methyl]piperazine-1-carboximidamide (PubChem CID 109450801) has the molecular formula C21H33F2N5 and a molecular weight of 393.53 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-methyl-N-[(1-propylpiperidin-4-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[(1-propylpiperidin-4-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109450801 |
| Molecular Formula | C21H33F2N5 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[(1-propylpiperidin-4-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCCN1CCC(CN/C(=N\C)N2CCN(c3cc(F)ccc3F)CC2)CC1 |
| InChI | InChI=1S/C21H33F2N5/c1-3-8-26-9-6-17(7-10-26)16-25-21(24-2)28-13-11-27(12-14-28)20-15-18(22)4-5-19(20)23/h4-5,15,17H,3,6-14,16H2,1-2H3,(H,24,25) |
| InChIKey | POWWTADONXEWEC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|