C18H26F2N4O2 — CID 109450581
tert-butyl 2-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]acetate (PubChem CID 109450581) has the molecular formula C18H26F2N4O2 and a molecular weight of 368.43 g/mol. Its IUPAC name is tert-butyl 2-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]acetate |
|---|---|
| PubChem CID | 109450581 |
| Molecular Formula | C18H26F2N4O2 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | tert-butyl 2-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]acetate |
| SMILES | C/N=C(\NCC(=O)OC(C)(C)C)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H26F2N4O2/c1-18(2,3)26-16(25)12-22-17(21-4)24-9-7-23(8-10-24)15-11-13(19)5-6-14(15)20/h5-6,11H,7-10,12H2,1-4H3,(H,21,22) |
| InChIKey | FLEHQGAHEJCBOI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|