C21H31F2N5O — CID 109450599
1-[[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 109450599) has the molecular formula C21H31F2N5O and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-[[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 109450599 |
| Molecular Formula | C21H31F2N5O |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 1-[[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | C/N=C(\NCC1(C(=O)N(C)C)CCCC1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C21H31F2N5O/c1-24-20(25-15-21(8-4-5-9-21)19(29)26(2)3)28-12-10-27(11-13-28)18-14-16(22)6-7-17(18)23/h6-7,14H,4-5,8-13,15H2,1-3H3,(H,24,25) |
| InChIKey | ZVHHUHWSUDRDFX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|