C19H30F2IN5O — CID 109450410
N-butan-2-yl-3-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide;hydroiodide (PubChem CID 109450410) has the molecular formula C19H30F2IN5O and a molecular weight of 509.38 g/mol. Its IUPAC name is N-butan-2-yl-3-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109450410 |
| Molecular Formula | C19H30F2IN5O |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | N-butan-2-yl-3-[[C-[4-(2,5-difluorophenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)N1CCN(c2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C19H29F2N5O.HI/c1-4-14(2)24-18(27)7-8-23-19(22-3)26-11-9-25(10-12-26)17-13-15(20)5-6-16(17)21;/h5-6,13-14H,4,7-12H2,1-3H3,(H,22,23)(H,24,27);1H |
| InChIKey | XIXGTRNBNBBNLQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|