C21H27F2N5O — CID 109451611
4-(2,5-difluorophenyl)-N'-methyl-N-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide (PubChem CID 109451611) has the molecular formula C21H27F2N5O and a molecular weight of 403.48 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N'-methyl-N-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451611 |
| Molecular Formula | C21H27F2N5O |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N'-methyl-N-[4-(2-oxo-1-pyridinyl)butyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCn1ccccc1=O)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C21H27F2N5O/c1-24-21(25-9-3-5-11-27-10-4-2-6-20(27)29)28-14-12-26(13-15-28)19-16-17(22)7-8-18(19)23/h2,4,6-8,10,16H,3,5,9,11-15H2,1H3,(H,24,25) |
| InChIKey | QAZVZCLGUWKJPT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|