C20H24F2N4OS — CID 109451285
N-[2-(benzenesulfinyl)ethyl]-4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 109451285) has the molecular formula C20H24F2N4OS and a molecular weight of 406.50 g/mol. Its IUPAC name is N-[2-(benzenesulfinyl)ethyl]-4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(benzenesulfinyl)ethyl]-4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109451285 |
| Molecular Formula | C20H24F2N4OS |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[2-(benzenesulfinyl)ethyl]-4-(2,5-difluorophenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCS(=O)c1ccccc1)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H24F2N4OS/c1-23-20(24-9-14-28(27)17-5-3-2-4-6-17)26-12-10-25(11-13-26)19-15-16(21)7-8-18(19)22/h2-8,15H,9-14H2,1H3,(H,23,24) |
| InChIKey | JOAVFYWZXXKPBO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|