C18H29F2N5O2S — CID 109450827
4-(2,5-difluorophenyl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 109450827) has the molecular formula C18H29F2N5O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109450827 |
| Molecular Formula | C18H29F2N5O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCS(=O)(=O)N(C)CCCN/C(=N\C)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H29F2N5O2S/c1-4-28(26,27)23(3)9-5-8-22-18(21-2)25-12-10-24(11-13-25)17-14-15(19)6-7-16(17)20/h6-7,14H,4-5,8-13H2,1-3H3,(H,21,22) |
| InChIKey | SCKDKJWGALDSCK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|