C18H30ClN5O2S — CID 111177640
4-(2-chlorophenyl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111177640) has the molecular formula C18H30ClN5O2S and a molecular weight of 415.99 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111177640 |
| Molecular Formula | C18H30ClN5O2S |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-(2-chlorophenyl)-N-[3-[ethylsulfonyl(methyl)amino]propyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCS(=O)(=O)N(C)CCCN/C(=N\C)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H30ClN5O2S/c1-4-27(25,26)22(3)11-7-10-21-18(20-2)24-14-12-23(13-15-24)17-9-6-5-8-16(17)19/h5-6,8-9H,4,7,10-15H2,1-3H3,(H,20,21) |
| InChIKey | WMUNJRDWUSMWGY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|