C21H28ClN5O2S — CID 111177782
4-(2-chlorophenyl)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111177782) has the molecular formula C21H28ClN5O2S and a molecular weight of 450.01 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(2-chlorophenyl)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111177782 |
| Molecular Formula | C21H28ClN5O2S |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 4-(2-chlorophenyl)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccccc1S(=O)(=O)N(C)C)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H28ClN5O2S/c1-23-21(24-16-17-8-4-7-11-20(17)30(28,29)25(2)3)27-14-12-26(13-15-27)19-10-6-5-9-18(19)22/h4-11H,12-16H2,1-3H3,(H,23,24) |
| InChIKey | GJSULTMMNXUXJN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|