C22H31IN4O3S — CID 109425927
N-[[2-(dimethylsulfamoyl)phenyl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109425927) has the molecular formula C22H31IN4O3S and a molecular weight of 558.49 g/mol. Its IUPAC name is N-[[2-(dimethylsulfamoyl)phenyl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[2-(dimethylsulfamoyl)phenyl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109425927 |
| Molecular Formula | C22H31IN4O3S |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N-[[2-(dimethylsulfamoyl)phenyl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1S(=O)(=O)N(C)C)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H30N4O3S.HI/c1-23-22(24-17-18-9-7-8-12-21(18)30(27,28)25(2)3)26-15-13-20(14-16-26)29-19-10-5-4-6-11-19;/h4-12,20H,13-17H2,1-3H3,(H,23,24);1H |
| InChIKey | JEKGEWAHTNADEG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|