C16H25N3O3S — CID 109425492
N'-methyl-N-(2-methylsulfonylethyl)-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109425492) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N'-methyl-N-(2-methylsulfonylethyl)-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N'-methyl-N-(2-methylsulfonylethyl)-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109425492 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N'-methyl-N-(2-methylsulfonylethyl)-4-phenoxypiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C16H25N3O3S/c1-17-16(18-10-13-23(2,20)21)19-11-8-15(9-12-19)22-14-6-4-3-5-7-14/h3-7,15H,8-13H2,1-2H3,(H,17,18) |
| InChIKey | NGBSOCLNIDUMKS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|