C21H29IN4O3S — CID 109426393
N'-methyl-4-phenoxy-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 109426393) has the molecular formula C21H29IN4O3S and a molecular weight of 544.46 g/mol. Its IUPAC name is N'-methyl-4-phenoxy-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-phenoxy-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109426393 |
| Molecular Formula | C21H29IN4O3S |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | N'-methyl-4-phenoxy-N-[2-(4-sulfamoylphenyl)ethyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(S(N)(=O)=O)cc1)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H28N4O3S.HI/c1-23-21(24-14-11-17-7-9-20(10-8-17)29(22,26)27)25-15-12-19(13-16-25)28-18-5-3-2-4-6-18;/h2-10,19H,11-16H2,1H3,(H,23,24)(H2,22,26,27);1H |
| InChIKey | RUGKDMRWLLCORC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|