C16H25FIN3O — CID 109425403
N-(3-fluoropropyl)-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109425403) has the molecular formula C16H25FIN3O and a molecular weight of 421.30 g/mol. Its IUPAC name is N-(3-fluoropropyl)-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-(3-fluoropropyl)-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109425403 |
| Molecular Formula | C16H25FIN3O |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-(3-fluoropropyl)-N'-methyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCF)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C16H24FN3O.HI/c1-18-16(19-11-5-10-17)20-12-8-15(9-13-20)21-14-6-3-2-4-7-14;/h2-4,6-7,15H,5,8-13H2,1H3,(H,18,19);1H |
| InChIKey | UZBUFHIMTKGXQO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|