C19H32IN3O — CID 109426779
N'-methyl-N-(4-methylpentyl)-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109426779) has the molecular formula C19H32IN3O and a molecular weight of 445.39 g/mol. Its IUPAC name is N'-methyl-N-(4-methylpentyl)-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-(4-methylpentyl)-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109426779 |
| Molecular Formula | C19H32IN3O |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N'-methyl-N-(4-methylpentyl)-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCC(C)C)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C19H31N3O.HI/c1-16(2)8-7-13-21-19(20-3)22-14-11-18(12-15-22)23-17-9-5-4-6-10-17;/h4-6,9-10,16,18H,7-8,11-15H2,1-3H3,(H,20,21);1H |
| InChIKey | LGJKCHQIRVXHGY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|