C22H31FIN5O2S — CID 111148234
N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethyl-4-(2-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111148234) has the molecular formula C22H31FIN5O2S and a molecular weight of 575.49 g/mol. Its IUPAC name is N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethyl-4-(2-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethyl-4-(2-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111148234 |
| Molecular Formula | C22H31FIN5O2S |
| Molecular Weight | 575.49 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethyl-4-(2-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)N1CCN(c2ccccc2F)CC1.I |
| InChI | InChI=1S/C22H30FN5O2S.HI/c1-4-24-22(25-17-18-9-5-8-12-21(18)31(29,30)26(2)3)28-15-13-27(14-16-28)20-11-7-6-10-19(20)23;/h5-12H,4,13-17H2,1-3H3,(H,24,25);1H |
| InChIKey | BIWNOSFDIPUCFS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|