C21H28FN5O2S — CID 111148829
N-ethyl-4-(2-fluorophenyl)-N'-[[3-(methylsulfamoyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 111148829) has the molecular formula C21H28FN5O2S and a molecular weight of 433.55 g/mol. Its IUPAC name is N-ethyl-4-(2-fluorophenyl)-N'-[[3-(methylsulfamoyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-fluorophenyl)-N'-[[3-(methylsulfamoyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111148829 |
| Molecular Formula | C21H28FN5O2S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-ethyl-4-(2-fluorophenyl)-N'-[[3-(methylsulfamoyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(S(=O)(=O)NC)c1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H28FN5O2S/c1-3-24-21(25-16-17-7-6-8-18(15-17)30(28,29)23-2)27-13-11-26(12-14-27)20-10-5-4-9-19(20)22/h4-10,15,23H,3,11-14,16H2,1-2H3,(H,24,25) |
| InChIKey | GGVOKQNYLQTLRI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|