C20H26FN5O2S — CID 111165105
N-ethyl-4-(4-fluorophenyl)-N'-[(3-sulfamoylphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111165105) has the molecular formula C20H26FN5O2S and a molecular weight of 419.53 g/mol. Its IUPAC name is N-ethyl-4-(4-fluorophenyl)-N'-[(3-sulfamoylphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(4-fluorophenyl)-N'-[(3-sulfamoylphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165105 |
| Molecular Formula | C20H26FN5O2S |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-ethyl-4-(4-fluorophenyl)-N'-[(3-sulfamoylphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H26FN5O2S/c1-2-23-20(24-15-16-4-3-5-19(14-16)29(22,27)28)26-12-10-25(11-13-26)18-8-6-17(21)7-9-18/h3-9,14H,2,10-13,15H2,1H3,(H,23,24)(H2,22,27,28) |
| InChIKey | ZTDXTMBADAJVRE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|