C22H30IN5O — CID 110961808
N-[3-[[[ethylamino-(4-phenylpiperazin-1-yl)methylidene]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 110961808) has the molecular formula C22H30IN5O and a molecular weight of 507.42 g/mol. Its IUPAC name is N-[3-[[[ethylamino-(4-phenylpiperazin-1-yl)methylidene]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-(4-phenylpiperazin-1-yl)methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110961808 |
| Molecular Formula | C22H30IN5O |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | N-[3-[[[ethylamino-(4-phenylpiperazin-1-yl)methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(C)=O)c1)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H29N5O.HI/c1-3-23-22(24-17-19-8-7-9-20(16-19)25-18(2)28)27-14-12-26(13-15-27)21-10-5-4-6-11-21;/h4-11,16H,3,12-15,17H2,1-2H3,(H,23,24)(H,25,28);1H |
| InChIKey | IZUVEGQJVBEHHF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|