C20H31IN4O — CID 109444016
N-[3-[[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 109444016) has the molecular formula C20H31IN4O and a molecular weight of 470.40 g/mol. Its IUPAC name is N-[3-[[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | N-[3-[[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109444016 |
| Molecular Formula | C20H31IN4O |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[3-[[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(C)=O)c1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C20H30N4O.HI/c1-3-21-20(24-13-17-8-4-5-9-18(17)14-24)22-12-16-7-6-10-19(11-16)23-15(2)25;/h6-7,10-11,17-18H,3-5,8-9,12-14H2,1-2H3,(H,21,22)(H,23,25);1H |
| InChIKey | TXRKOQMZFVKATP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|