C19H28N4O — CID 109443781
3-[[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]methyl]benzamide (PubChem CID 109443781) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 3-[[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | 3-[[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 109443781 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 3-[[[1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl(ethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C19H28N4O/c1-2-21-19(23-12-16-7-3-4-8-17(16)13-23)22-11-14-6-5-9-15(10-14)18(20)24/h5-6,9-10,16-17H,2-4,7-8,11-13H2,1H3,(H2,20,24)(H,21,22) |
| InChIKey | AVBZEVVHFLPDPI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|