C22H31N5 — CID 109444369
N-ethyl-N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109444369) has the molecular formula C22H31N5 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-ethyl-N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109444369 |
| Molecular Formula | C22H31N5 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | N-ethyl-N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2ccnc2)c1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C22H31N5/c1-2-24-22(27-15-20-8-3-4-9-21(20)16-27)25-13-18-6-5-7-19(12-18)14-26-11-10-23-17-26/h5-7,10-12,17,20-21H,2-4,8-9,13-16H2,1H3,(H,24,25) |
| InChIKey | OHGQMJJYRNGYSN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|