C18H29IN4O2S — CID 109441936
N-ethyl-N'-[(3-sulfamoylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109441936) has the molecular formula C18H29IN4O2S and a molecular weight of 492.43 g/mol. Its IUPAC name is N-ethyl-N'-[(3-sulfamoylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(3-sulfamoylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109441936 |
| Molecular Formula | C18H29IN4O2S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N-ethyl-N'-[(3-sulfamoylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C18H28N4O2S.HI/c1-2-20-18(22-12-15-7-3-4-8-16(15)13-22)21-11-14-6-5-9-17(10-14)25(19,23)24;/h5-6,9-10,15-16H,2-4,7-8,11-13H2,1H3,(H,20,21)(H2,19,23,24);1H |
| InChIKey | VFRFSOYUGJKQEE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|