C14H23IN4O2S — CID 111870205
1-(cyclopropylmethyl)-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111870205) has the molecular formula C14H23IN4O2S and a molecular weight of 438.34 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(cyclopropylmethyl)-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111870205 |
| Molecular Formula | C14H23IN4O2S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)NCC1CC1.I |
| InChI | InChI=1S/C14H22N4O2S.HI/c1-2-16-14(17-9-11-6-7-11)18-10-12-4-3-5-13(8-12)21(15,19)20;/h3-5,8,11H,2,6-7,9-10H2,1H3,(H2,15,19,20)(H2,16,17,18);1H |
| InChIKey | FBUHYJHCKAMHBT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|