C24H28N4O2S — CID 111356902
1-(2,2-diphenylethyl)-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111356902) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-(2,2-diphenylethyl)-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111356902 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-(2,2-diphenylethyl)-3-ethyl-2-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O2S/c1-2-26-24(27-17-19-10-9-15-22(16-19)31(25,29)30)28-18-23(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-16,23H,2,17-18H2,1H3,(H2,25,29,30)(H2,26,27,28) |
| InChIKey | OOGNCEKZZFWXTG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|