C25H28N4O — CID 111356892
4-[[[(2,2-diphenylethylamino)-(ethylamino)methylidene]amino]methyl]benzamide (PubChem CID 111356892) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 4-[[[(2,2-diphenylethylamino)-(ethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | 4-[[[(2,2-diphenylethylamino)-(ethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111356892 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 4-[[[(2,2-diphenylethylamino)-(ethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)cc1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O/c1-2-27-25(28-17-19-13-15-22(16-14-19)24(26)30)29-18-23(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,23H,2,17-18H2,1H3,(H2,26,30)(H2,27,28,29) |
| InChIKey | SQNISGNHQFHLNX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|