C16H20N4OS — CID 111257893
4-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]benzamide (PubChem CID 111257893) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 4-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | 4-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111257893 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)cc1)NCc1cccs1 |
| InChI | InChI=1S/C16H20N4OS/c1-2-18-16(20-11-14-4-3-9-22-14)19-10-12-5-7-13(8-6-12)15(17)21/h3-9H,2,10-11H2,1H3,(H2,17,21)(H2,18,19,20) |
| InChIKey | ROCQZTJMWSHOCN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|