C21H30IN5O2S — CID 111674397
N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111674397) has the molecular formula C21H30IN5O2S and a molecular weight of 543.48 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111674397 |
| Molecular Formula | C21H30IN5O2S |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)NCC(C)Cc1cccs1.I |
| InChI | InChI=1S/C21H29N5O2S.HI/c1-3-23-21(25-12-15(2)11-18-5-4-10-29-18)26-13-16-6-8-17(9-7-16)20(28)24-14-19(22)27;/h4-10,15H,3,11-14H2,1-2H3,(H2,22,27)(H,24,28)(H2,23,25,26);1H |
| InChIKey | HJWDOKLJZSIUOK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|