C17H22N4OS — CID 111349236
4-[[[ethylamino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]benzamide (PubChem CID 111349236) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 4-[[[ethylamino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | 4-[[[ethylamino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111349236 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-[[[ethylamino-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C17H22N4OS/c1-2-19-17(20-10-9-15-4-3-11-23-15)21-12-13-5-7-14(8-6-13)16(18)22/h3-8,11H,2,9-10,12H2,1H3,(H2,18,22)(H2,19,20,21) |
| InChIKey | ABEUCMLPSMAHMM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|