C18H25IN4O2S — CID 111257194
2-[4-[2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide (PubChem CID 111257194) has the molecular formula C18H25IN4O2S and a molecular weight of 488.40 g/mol. Its IUPAC name is 2-[4-[2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[4-[2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111257194 |
| Molecular Formula | C18H25IN4O2S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 2-[4-[2-[[N-ethyl-N'-(thiophen-2-ylmethyl)carbamimidoyl]amino]ethyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccs1)NCCc1ccc(OCC(N)=O)cc1.I |
| InChI | InChI=1S/C18H24N4O2S.HI/c1-2-20-18(22-12-16-4-3-11-25-16)21-10-9-14-5-7-15(8-6-14)24-13-17(19)23;/h3-8,11H,2,9-10,12-13H2,1H3,(H2,19,23)(H2,20,21,22);1H |
| InChIKey | MXSIWVVNJNCMMW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|